C27H44ClN5O3 — CID 46225037
(3R)-3-[(1S)-4-(carbamoylamino)-1-(3-chlorophenyl)-1-hydroxybutyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide (PubChem CID 46225037) has the molecular formula C27H44ClN5O3 and a molecular weight of 522.13 g/mol. Its IUPAC name is (3R)-3-[(1S)-4-(carbamoylamino)-1-(3-chlorophenyl)-1-hydroxybutyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-[(1S)-4-(carbamoylamino)-1-(3-chlorophenyl)-1-hydroxybutyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 46225037 |
| Molecular Formula | C27H44ClN5O3 |
| Molecular Weight | 522.13 g/mol |
| Exact Mass | 521.31 |
| IUPAC Name | (3R)-3-[(1S)-4-(carbamoylamino)-1-(3-chlorophenyl)-1-hydroxybutyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
| SMILES | CNC[C@H](CC1CCCCC1)NC(=O)N1CCC[C@@H]([C@@](O)(CCCNC(N)=O)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C27H44ClN5O3/c1-30-18-24(16-20-8-3-2-4-9-20)32-26(35)33-15-6-11-22(19-33)27(36,13-7-14-31-25(29)34)21-10-5-12-23(28)17-21/h5,10,12,17,20,22,24,30,36H,2-4,6-9,11,13-16,18-19H2,1H3,(H,32,35)(H3,29,31,34)/t22-,24+,27-/m1/s1 |
| InChIKey | XXQKRNVVWCJOMV-RWCIVJTCSA-N |
| XLogP | 3.96 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.13 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|