C30H47ClN4O3 — CID 46225071
(3R)-3-[(1S)-1-(3-chlorophenyl)-4-(cyclopropanecarbonylamino)-1-hydroxybutyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide (PubChem CID 46225071) has the molecular formula C30H47ClN4O3 and a molecular weight of 547.18 g/mol. Its IUPAC name is (3R)-3-[(1S)-1-(3-chlorophenyl)-4-(cyclopropanecarbonylamino)-1-hydroxybutyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-[(1S)-1-(3-chlorophenyl)-4-(cyclopropanecarbonylamino)-1-hydroxybutyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 46225071 |
| Molecular Formula | C30H47ClN4O3 |
| Molecular Weight | 547.18 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | (3R)-3-[(1S)-1-(3-chlorophenyl)-4-(cyclopropanecarbonylamino)-1-hydroxybutyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
| SMILES | CNC[C@H](CC1CCCCC1)NC(=O)N1CCC[C@@H]([C@@](O)(CCCNC(=O)C2CC2)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C30H47ClN4O3/c1-32-20-27(18-22-8-3-2-4-9-22)34-29(37)35-17-6-11-25(21-35)30(38,24-10-5-12-26(31)19-24)15-7-16-33-28(36)23-13-14-23/h5,10,12,19,22-23,25,27,32,38H,2-4,6-9,11,13-18,20-21H2,1H3,(H,33,36)(H,34,37)/t25-,27+,30-/m1/s1 |
| InChIKey | HPVVKNNRNANXAZ-JUFIIOIISA-N |
| XLogP | 4.81 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.18 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|