C30H49ClN4O3 — CID 46225072
(3R)-3-[(1S)-4-(butanoylamino)-1-(3-chlorophenyl)-1-hydroxybutyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide (PubChem CID 46225072) has the molecular formula C30H49ClN4O3 and a molecular weight of 549.20 g/mol. Its IUPAC name is (3R)-3-[(1S)-4-(butanoylamino)-1-(3-chlorophenyl)-1-hydroxybutyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-[(1S)-4-(butanoylamino)-1-(3-chlorophenyl)-1-hydroxybutyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 46225072 |
| Molecular Formula | C30H49ClN4O3 |
| Molecular Weight | 549.20 g/mol |
| Exact Mass | 548.35 |
| IUPAC Name | (3R)-3-[(1S)-4-(butanoylamino)-1-(3-chlorophenyl)-1-hydroxybutyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
| SMILES | CCCC(=O)NCCC[C@@](O)(c1cccc(Cl)c1)[C@@H]1CCCN(C(=O)N[C@H](CNC)CC2CCCCC2)C1 |
| InChI | InChI=1S/C30H49ClN4O3/c1-3-10-28(36)33-17-9-16-30(38,24-13-7-15-26(31)20-24)25-14-8-18-35(22-25)29(37)34-27(21-32-2)19-23-11-5-4-6-12-23/h7,13,15,20,23,25,27,32,38H,3-6,8-12,14,16-19,21-22H2,1-2H3,(H,33,36)(H,34,37)/t25-,27+,30-/m1/s1 |
| InChIKey | YYHKUVHOQVCOGJ-JUFIIOIISA-N |
| XLogP | 5.20 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.20 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|