C29H47ClN4O3 — CID 46225073
(3R)-3-[(1S)-1-(3-chlorophenyl)-1-hydroxy-4-(propanoylamino)butyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide (PubChem CID 46225073) has the molecular formula C29H47ClN4O3 and a molecular weight of 535.17 g/mol. Its IUPAC name is (3R)-3-[(1S)-1-(3-chlorophenyl)-1-hydroxy-4-(propanoylamino)butyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-[(1S)-1-(3-chlorophenyl)-1-hydroxy-4-(propanoylamino)butyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 46225073 |
| Molecular Formula | C29H47ClN4O3 |
| Molecular Weight | 535.17 g/mol |
| Exact Mass | 534.33 |
| IUPAC Name | (3R)-3-[(1S)-1-(3-chlorophenyl)-1-hydroxy-4-(propanoylamino)butyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
| SMILES | CCC(=O)NCCC[C@@](O)(c1cccc(Cl)c1)[C@@H]1CCCN(C(=O)N[C@H](CNC)CC2CCCCC2)C1 |
| InChI | InChI=1S/C29H47ClN4O3/c1-3-27(35)32-16-9-15-29(37,23-12-7-14-25(30)19-23)24-13-8-17-34(21-24)28(36)33-26(20-31-2)18-22-10-5-4-6-11-22/h7,12,14,19,22,24,26,31,37H,3-6,8-11,13,15-18,20-21H2,1-2H3,(H,32,35)(H,33,36)/t24-,26+,29-/m1/s1 |
| InChIKey | NKSWZMBNAZQJQX-DOBADDLBSA-N |
| XLogP | 4.81 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.17 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|