C30H28FN3O3 — CID 46225164
N-[3-(5-fluoro-1H-indol-3-yl)propyl]-N-(1-oxo-2,3,4,8,9,10-hexahydropyrano[2,3-h]isoquinolin-9-yl)benzamide (PubChem CID 46225164) has the molecular formula C30H28FN3O3 and a molecular weight of 497.57 g/mol. Its IUPAC name is N-[3-(5-fluoro-1H-indol-3-yl)propyl]-N-(1-oxo-2,3,4,8,9,10-hexahydropyrano[2,3-h]isoquinolin-9-yl)benzamide.
| Compound Name | N-[3-(5-fluoro-1H-indol-3-yl)propyl]-N-(1-oxo-2,3,4,8,9,10-hexahydropyrano[2,3-h]isoquinolin-9-yl)benzamide |
|---|---|
| PubChem CID | 46225164 |
| Molecular Formula | C30H28FN3O3 |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | N-[3-(5-fluoro-1H-indol-3-yl)propyl]-N-(1-oxo-2,3,4,8,9,10-hexahydropyrano[2,3-h]isoquinolin-9-yl)benzamide |
| SMILES | O=C1NCCc2ccc3c(c21)CC(N(CCCc1c[nH]c2ccc(F)cc12)C(=O)c1ccccc1)CO3 |
| InChI | InChI=1S/C30H28FN3O3/c31-22-9-10-26-24(15-22)21(17-33-26)7-4-14-34(30(36)20-5-2-1-3-6-20)23-16-25-27(37-18-23)11-8-19-12-13-32-29(35)28(19)25/h1-3,5-6,8-11,15,17,23,33H,4,7,12-14,16,18H2,(H,32,35) |
| InChIKey | ZLNFUFOORAFJJW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |