About 2-amino-5,5-dicyclohexyl-3-methylimidazol-4-one
2-amino-5,5-dicyclohexyl-3-methylimidazol-4-one (PubChem CID 46225190) has the molecular formula C16H27N3O
and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-amino-5,5-dicyclohexyl-3-methylimidazol-4-one.
Molecular Properties
| Compound Name | 2-amino-5,5-dicyclohexyl-3-methylimidazol-4-one |
| PubChem CID | 46225190 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | 2-amino-5,5-dicyclohexyl-3-methylimidazol-4-one |
| SMILES | CN1C(=O)C(C2CCCCC2)(C2CCCCC2)N=C1N |
| InChI | InChI=1S/C16H27N3O/c1-19-14(20)16(18-15(19)17,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h12-13H,2-11H2,1H3,(H2,17,18) |
| InChIKey | IAMIFCZOYVOTFD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-5,5-dicyclohexyl-3-methylimidazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5,5-dicyclohexyl-3-methylimidazol-4-one?
The IUPAC name of 2-amino-5,5-dicyclohexyl-3-methylimidazol-4-one (CID 46225190) is 2-amino-5,5-dicyclohexyl-3-methylimidazol-4-one.
What is the SMILES notation for 2-amino-5,5-dicyclohexyl-3-methylimidazol-4-one?
The canonical SMILES for 2-amino-5,5-dicyclohexyl-3-methylimidazol-4-one is CN1C(=O)C(C2CCCCC2)(C2CCCCC2)N=C1N.
What is the InChIKey of 2-amino-5,5-dicyclohexyl-3-methylimidazol-4-one?
The InChIKey is IAMIFCZOYVOTFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N3O/c1-19-14(20)16(18-15(19)17,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h12-13H,2-11H2,1H3,(H2,17,18).
What are the key properties of 2-amino-5,5-dicyclohexyl-3-methylimidazol-4-one?
2-amino-5,5-dicyclohexyl-3-methylimidazol-4-one has a molecular weight of 277.41 g/mol, XLogP of 2.67, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5,5-dicyclohexyl-3-methylimidazol-4-one is sourced from PubChem (CID 46225190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).