C19H11F3N4O — CID 46225276
2,4,5-trifluoro-6-(1-imidazolidin-2-ylidene-2-oxo-2-phenylethyl)benzene-1,3-dicarbonitrile (PubChem CID 46225276) has the molecular formula C19H11F3N4O and a molecular weight of 368.32 g/mol. Its IUPAC name is 2,4,5-trifluoro-6-(1-imidazolidin-2-ylidene-2-oxo-2-phenylethyl)benzene-1,3-dicarbonitrile.
| Compound Name | 2,4,5-trifluoro-6-(1-imidazolidin-2-ylidene-2-oxo-2-phenylethyl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 46225276 |
| Molecular Formula | C19H11F3N4O |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 2,4,5-trifluoro-6-(1-imidazolidin-2-ylidene-2-oxo-2-phenylethyl)benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1c(F)c(F)c(C(C(=O)c2ccccc2)=C2NCCN2)c(C#N)c1F |
| InChI | InChI=1S/C19H11F3N4O/c20-15-11(8-23)13(17(22)16(21)12(15)9-24)14(19-25-6-7-26-19)18(27)10-4-2-1-3-5-10/h1-5,25-26H,6-7H2 |
| InChIKey | USRSTXBTWFWHSP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|