About 4-[2-(1,3-benzodioxol-5-yl)-7H-purin-6-yl]morpholine
4-[2-(1,3-benzodioxol-5-yl)-7H-purin-6-yl]morpholine (PubChem CID 46225307) has the molecular formula C16H15N5O3
and a molecular weight of 325.33 g/mol. Its IUPAC name is 4-[2-(1,3-benzodioxol-5-yl)-7H-purin-6-yl]morpholine.
Molecular Properties
| Compound Name | 4-[2-(1,3-benzodioxol-5-yl)-7H-purin-6-yl]morpholine |
| PubChem CID | 46225307 |
| Molecular Formula | C16H15N5O3 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 4-[2-(1,3-benzodioxol-5-yl)-7H-purin-6-yl]morpholine |
| SMILES | c1nc2nc(-c3ccc4c(c3)OCO4)nc(N3CCOCC3)c2[nH]1 |
| InChI | InChI=1S/C16H15N5O3/c1-2-11-12(24-9-23-11)7-10(1)14-19-15-13(17-8-18-15)16(20-14)21-3-5-22-6-4-21/h1-2,7-8H,3-6,9H2,(H,17,18,19,20) |
| InChIKey | HWVQDXXMHUAOHV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 85.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[2-(1,3-benzodioxol-5-yl)-7H-purin-6-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1,3-benzodioxol-5-yl)-7H-purin-6-yl]morpholine?
The IUPAC name of 4-[2-(1,3-benzodioxol-5-yl)-7H-purin-6-yl]morpholine (CID 46225307) is 4-[2-(1,3-benzodioxol-5-yl)-7H-purin-6-yl]morpholine.
What is the SMILES notation for 4-[2-(1,3-benzodioxol-5-yl)-7H-purin-6-yl]morpholine?
The canonical SMILES for 4-[2-(1,3-benzodioxol-5-yl)-7H-purin-6-yl]morpholine is c1nc2nc(-c3ccc4c(c3)OCO4)nc(N3CCOCC3)c2[nH]1.
What is the InChIKey of 4-[2-(1,3-benzodioxol-5-yl)-7H-purin-6-yl]morpholine?
The InChIKey is HWVQDXXMHUAOHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N5O3/c1-2-11-12(24-9-23-11)7-10(1)14-19-15-13(17-8-18-15)16(20-14)21-3-5-22-6-4-21/h1-2,7-8H,3-6,9H2,(H,17,18,19,20).
What are the key properties of 4-[2-(1,3-benzodioxol-5-yl)-7H-purin-6-yl]morpholine?
4-[2-(1,3-benzodioxol-5-yl)-7H-purin-6-yl]morpholine has a molecular weight of 325.33 g/mol, XLogP of 1.59, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1,3-benzodioxol-5-yl)-7H-purin-6-yl]morpholine is sourced from PubChem (CID 46225307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).