C23H23N7O2S — CID 46225321
3-[1-(1-methylsulfonylpiperidin-4-yl)triazol-4-yl]-5,6-diphenyl-1,2,4-triazine (PubChem CID 46225321) has the molecular formula C23H23N7O2S and a molecular weight of 461.55 g/mol. Its IUPAC name is 3-[1-(1-methylsulfonylpiperidin-4-yl)triazol-4-yl]-5,6-diphenyl-1,2,4-triazine.
| Compound Name | 3-[1-(1-methylsulfonylpiperidin-4-yl)triazol-4-yl]-5,6-diphenyl-1,2,4-triazine |
|---|---|
| PubChem CID | 46225321 |
| Molecular Formula | C23H23N7O2S |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 3-[1-(1-methylsulfonylpiperidin-4-yl)triazol-4-yl]-5,6-diphenyl-1,2,4-triazine |
| SMILES | CS(=O)(=O)N1CCC(n2cc(-c3nnc(-c4ccccc4)c(-c4ccccc4)n3)nn2)CC1 |
| InChI | InChI=1S/C23H23N7O2S/c1-33(31,32)29-14-12-19(13-15-29)30-16-20(25-28-30)23-24-21(17-8-4-2-5-9-17)22(26-27-23)18-10-6-3-7-11-18/h2-11,16,19H,12-15H2,1H3 |
| InChIKey | MUASWRSEGWMCGB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 106.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |