C18H14O6S — CID 46225351
3-(4-methoxyphenyl)-4-(4-methylsulfonylphenyl)furan-2,5-dione (PubChem CID 46225351) has the molecular formula C18H14O6S and a molecular weight of 358.37 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-4-(4-methylsulfonylphenyl)furan-2,5-dione.
| Compound Name | 3-(4-methoxyphenyl)-4-(4-methylsulfonylphenyl)furan-2,5-dione |
|---|---|
| PubChem CID | 46225351 |
| Molecular Formula | C18H14O6S |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 3-(4-methoxyphenyl)-4-(4-methylsulfonylphenyl)furan-2,5-dione |
| SMILES | COc1ccc(C2=C(c3ccc(S(C)(=O)=O)cc3)C(=O)OC2=O)cc1 |
| InChI | InChI=1S/C18H14O6S/c1-23-13-7-3-11(4-8-13)15-16(18(20)24-17(15)19)12-5-9-14(10-6-12)25(2,21)22/h3-10H,1-2H3 |
| InChIKey | BQTJPJZRTBATNV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|