C24H31F8NO2 — CID 46225360
2-[(2S,3R)-4,4-difluoro-1-(1,1,1-trifluoro-7,7-dimethyloctan-4-yl)-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]acetic acid (PubChem CID 46225360) has the molecular formula C24H31F8NO2 and a molecular weight of 517.50 g/mol. Its IUPAC name is 2-[(2S,3R)-4,4-difluoro-1-(1,1,1-trifluoro-7,7-dimethyloctan-4-yl)-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[(2S,3R)-4,4-difluoro-1-(1,1,1-trifluoro-7,7-dimethyloctan-4-yl)-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 46225360 |
| Molecular Formula | C24H31F8NO2 |
| Molecular Weight | 517.50 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | 2-[(2S,3R)-4,4-difluoro-1-(1,1,1-trifluoro-7,7-dimethyloctan-4-yl)-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]acetic acid |
| SMILES | CC(C)(C)CCC(CCC(F)(F)F)N1CCC(F)(F)[C@H](CC(=O)O)C1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H31F8NO2/c1-21(2,3)10-8-17(9-11-23(27,28)29)33-13-12-22(25,26)18(14-19(34)35)20(33)15-4-6-16(7-5-15)24(30,31)32/h4-7,17-18,20H,8-14H2,1-3H3,(H,34,35)/t17?,18-,20?/m1/s1 |
| InChIKey | MNZOWHRBLOXBBE-QPIRBTGLSA-N |
| XLogP | 7.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.50 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |