About 4-[[5-[2-[(3,4-difluorophenyl)methylcarbamoyl]-4-pyridinyl]tetrazol-2-yl]methyl]benzoic acid
4-[[5-[2-[(3,4-difluorophenyl)methylcarbamoyl]-4-pyridinyl]tetrazol-2-yl]methyl]benzoic acid (PubChem CID 46225437) has the molecular formula C22H16F2N6O3
and a molecular weight of 450.41 g/mol. Its IUPAC name is 4-[[5-[2-[(3,4-difluorophenyl)methylcarbamoyl]-4-pyridinyl]tetrazol-2-yl]methyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[[5-[2-[(3,4-difluorophenyl)methylcarbamoyl]-4-pyridinyl]tetrazol-2-yl]methyl]benzoic acid |
| PubChem CID | 46225437 |
| Molecular Formula | C22H16F2N6O3 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 4-[[5-[2-[(3,4-difluorophenyl)methylcarbamoyl]-4-pyridinyl]tetrazol-2-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cn2nnc(-c3ccnc(C(=O)NCc4ccc(F)c(F)c4)c3)n2)cc1 |
| InChI | InChI=1S/C22H16F2N6O3/c23-17-6-3-14(9-18(17)24)11-26-21(31)19-10-16(7-8-25-19)20-27-29-30(28-20)12-13-1-4-15(5-2-13)22(32)33/h1-10H,11-12H2,(H,26,31)(H,32,33) |
| InChIKey | SPWCOBSWFOORCI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[[5-[2-[(3,4-difluorophenyl)methylcarbamoyl]-4-pyridinyl]tetrazol-2-yl]methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[5-[2-[(3,4-difluorophenyl)methylcarbamoyl]-4-pyridinyl]tetrazol-2-yl]methyl]benzoic acid?
The IUPAC name of 4-[[5-[2-[(3,4-difluorophenyl)methylcarbamoyl]-4-pyridinyl]tetrazol-2-yl]methyl]benzoic acid (CID 46225437) is 4-[[5-[2-[(3,4-difluorophenyl)methylcarbamoyl]-4-pyridinyl]tetrazol-2-yl]methyl]benzoic acid.
What is the SMILES notation for 4-[[5-[2-[(3,4-difluorophenyl)methylcarbamoyl]-4-pyridinyl]tetrazol-2-yl]methyl]benzoic acid?
The canonical SMILES for 4-[[5-[2-[(3,4-difluorophenyl)methylcarbamoyl]-4-pyridinyl]tetrazol-2-yl]methyl]benzoic acid is O=C(O)c1ccc(Cn2nnc(-c3ccnc(C(=O)NCc4ccc(F)c(F)c4)c3)n2)cc1.
What is the InChIKey of 4-[[5-[2-[(3,4-difluorophenyl)methylcarbamoyl]-4-pyridinyl]tetrazol-2-yl]methyl]benzoic acid?
The InChIKey is SPWCOBSWFOORCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16F2N6O3/c23-17-6-3-14(9-18(17)24)11-26-21(31)19-10-16(7-8-25-19)20-27-29-30(28-20)12-13-1-4-15(5-2-13)22(32)33/h1-10H,11-12H2,(H,26,31)(H,32,33).
What are the key properties of 4-[[5-[2-[(3,4-difluorophenyl)methylcarbamoyl]-4-pyridinyl]tetrazol-2-yl]methyl]benzoic acid?
4-[[5-[2-[(3,4-difluorophenyl)methylcarbamoyl]-4-pyridinyl]tetrazol-2-yl]methyl]benzoic acid has a molecular weight of 450.41 g/mol, XLogP of 2.69, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[5-[2-[(3,4-difluorophenyl)methylcarbamoyl]-4-pyridinyl]tetrazol-2-yl]methyl]benzoic acid is sourced from PubChem (CID 46225437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).