C20H39N3 — CID 46225450
(E)-1-azido-3,7,11,15-tetramethylhexadec-2-ene (PubChem CID 46225450) has the molecular formula C20H39N3 and a molecular weight of 321.55 g/mol. Its IUPAC name is (E)-1-azido-3,7,11,15-tetramethylhexadec-2-ene.
| Compound Name | (E)-1-azido-3,7,11,15-tetramethylhexadec-2-ene |
|---|---|
| PubChem CID | 46225450 |
| Molecular Formula | C20H39N3 |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 321.31 |
| IUPAC Name | (E)-1-azido-3,7,11,15-tetramethylhexadec-2-ene |
| SMILES | C/C(=C\CN=[N+]=[N-])CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C20H39N3/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-22-23-21/h15,17-19H,6-14,16H2,1-5H3/b20-15+ |
| InChIKey | JRQXBWXUQRYIAE-HMMYKYKNSA-N |
| XLogP | 7.68 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|