About 6-[[(3R,4R)-4-(2-azidoethoxy)pyrrolidin-3-yl]methyl]-4-methylpyridin-2-amine
6-[[(3R,4R)-4-(2-azidoethoxy)pyrrolidin-3-yl]methyl]-4-methylpyridin-2-amine (PubChem CID 46225763) has the molecular formula C13H20N6O
and a molecular weight of 276.34 g/mol. Its IUPAC name is 6-[[(3R,4R)-4-(2-azidoethoxy)pyrrolidin-3-yl]methyl]-4-methylpyridin-2-amine.
Molecular Properties
| Compound Name | 6-[[(3R,4R)-4-(2-azidoethoxy)pyrrolidin-3-yl]methyl]-4-methylpyridin-2-amine |
| PubChem CID | 46225763 |
| Molecular Formula | C13H20N6O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 6-[[(3R,4R)-4-(2-azidoethoxy)pyrrolidin-3-yl]methyl]-4-methylpyridin-2-amine |
| SMILES | Cc1cc(N)nc(C[C@@H]2CNC[C@@H]2OCCN=[N+]=[N-])c1 |
| InChI | InChI=1S/C13H20N6O/c1-9-4-11(18-13(14)5-9)6-10-7-16-8-12(10)20-3-2-17-19-15/h4-5,10,12,16H,2-3,6-8H2,1H3,(H2,14,18)/t10-,12+/m1/s1 |
| InChIKey | HHAWQCWTBXSJCG-PWSUYJOCSA-N |
| XLogP | 1.43 |
| TPSA | 108.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 6-[[(3R,4R)-4-(2-azidoethoxy)pyrrolidin-3-yl]methyl]-4-methylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[(3R,4R)-4-(2-azidoethoxy)pyrrolidin-3-yl]methyl]-4-methylpyridin-2-amine?
The IUPAC name of 6-[[(3R,4R)-4-(2-azidoethoxy)pyrrolidin-3-yl]methyl]-4-methylpyridin-2-amine (CID 46225763) is 6-[[(3R,4R)-4-(2-azidoethoxy)pyrrolidin-3-yl]methyl]-4-methylpyridin-2-amine.
What is the SMILES notation for 6-[[(3R,4R)-4-(2-azidoethoxy)pyrrolidin-3-yl]methyl]-4-methylpyridin-2-amine?
The canonical SMILES for 6-[[(3R,4R)-4-(2-azidoethoxy)pyrrolidin-3-yl]methyl]-4-methylpyridin-2-amine is Cc1cc(N)nc(C[C@@H]2CNC[C@@H]2OCCN=[N+]=[N-])c1.
What is the InChIKey of 6-[[(3R,4R)-4-(2-azidoethoxy)pyrrolidin-3-yl]methyl]-4-methylpyridin-2-amine?
The InChIKey is HHAWQCWTBXSJCG-PWSUYJOCSA-N. The full InChI is InChI=1S/C13H20N6O/c1-9-4-11(18-13(14)5-9)6-10-7-16-8-12(10)20-3-2-17-19-15/h4-5,10,12,16H,2-3,6-8H2,1H3,(H2,14,18)/t10-,12+/m1/s1.
What are the key properties of 6-[[(3R,4R)-4-(2-azidoethoxy)pyrrolidin-3-yl]methyl]-4-methylpyridin-2-amine?
6-[[(3R,4R)-4-(2-azidoethoxy)pyrrolidin-3-yl]methyl]-4-methylpyridin-2-amine has a molecular weight of 276.34 g/mol, XLogP of 1.43, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[(3R,4R)-4-(2-azidoethoxy)pyrrolidin-3-yl]methyl]-4-methylpyridin-2-amine is sourced from PubChem (CID 46225763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).