About disodium;(2S,3S)-2-hydroxy-3-methylsulfanylbutanedioate
disodium;(2S,3S)-2-hydroxy-3-methylsulfanylbutanedioate (PubChem CID 46225861) has the molecular formula C5H6Na2O5S
and a molecular weight of 224.14 g/mol. Its IUPAC name is disodium;(2S,3S)-2-hydroxy-3-methylsulfanylbutanedioate.
Molecular Properties
| Compound Name | disodium;(2S,3S)-2-hydroxy-3-methylsulfanylbutanedioate |
| PubChem CID | 46225861 |
| Molecular Formula | C5H6Na2O5S |
| Molecular Weight | 224.14 g/mol |
| Exact Mass | 223.97 |
| IUPAC Name | disodium;(2S,3S)-2-hydroxy-3-methylsulfanylbutanedioate |
| SMILES | CS[C@H](C(=O)[O-])[C@@H](O)C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C5H8O5S.2Na/c1-11-3(5(9)10)2(6)4(7)8;;/h2-3,6H,1H3,(H,7,8)(H,9,10);;/q;2*+1/p-2/t2-,3+;;/m1../s1 |
| InChIKey | MXEMIIHIRYSLDE-OTUWWBTESA-L |
| XLogP | -9.41 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.14 |
| LogP ≤ 5 | -9.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze disodium;(2S,3S)-2-hydroxy-3-methylsulfanylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;(2S,3S)-2-hydroxy-3-methylsulfanylbutanedioate?
The IUPAC name of disodium;(2S,3S)-2-hydroxy-3-methylsulfanylbutanedioate (CID 46225861) is disodium;(2S,3S)-2-hydroxy-3-methylsulfanylbutanedioate.
What is the SMILES notation for disodium;(2S,3S)-2-hydroxy-3-methylsulfanylbutanedioate?
The canonical SMILES for disodium;(2S,3S)-2-hydroxy-3-methylsulfanylbutanedioate is CS[C@H](C(=O)[O-])[C@@H](O)C(=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;(2S,3S)-2-hydroxy-3-methylsulfanylbutanedioate?
The InChIKey is MXEMIIHIRYSLDE-OTUWWBTESA-L. The full InChI is InChI=1S/C5H8O5S.2Na/c1-11-3(5(9)10)2(6)4(7)8;;/h2-3,6H,1H3,(H,7,8)(H,9,10);;/q;2*+1/p-2/t2-,3+;;/m1../s1.
What are the key properties of disodium;(2S,3S)-2-hydroxy-3-methylsulfanylbutanedioate?
disodium;(2S,3S)-2-hydroxy-3-methylsulfanylbutanedioate has a molecular weight of 224.14 g/mol, XLogP of -9.41, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;(2S,3S)-2-hydroxy-3-methylsulfanylbutanedioate is sourced from PubChem (CID 46225861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).