C27H36N2O3 — CID 46225942
5-(3-methoxyphenyl)-3-methyl-6-nonyl-7,8-dihydro-5H-[1,3]oxazolo[5,4-g]isoquinolin-2-one (PubChem CID 46225942) has the molecular formula C27H36N2O3 and a molecular weight of 436.60 g/mol. Its IUPAC name is 5-(3-methoxyphenyl)-3-methyl-6-nonyl-7,8-dihydro-5H-[1,3]oxazolo[5,4-g]isoquinolin-2-one.
| Compound Name | 5-(3-methoxyphenyl)-3-methyl-6-nonyl-7,8-dihydro-5H-[1,3]oxazolo[5,4-g]isoquinolin-2-one |
|---|---|
| PubChem CID | 46225942 |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | 5-(3-methoxyphenyl)-3-methyl-6-nonyl-7,8-dihydro-5H-[1,3]oxazolo[5,4-g]isoquinolin-2-one |
| SMILES | CCCCCCCCCN1CCc2cc3oc(=O)n(C)c3cc2C1c1cccc(OC)c1 |
| InChI | InChI=1S/C27H36N2O3/c1-4-5-6-7-8-9-10-15-29-16-14-20-18-25-24(28(2)27(30)32-25)19-23(20)26(29)21-12-11-13-22(17-21)31-3/h11-13,17-19,26H,4-10,14-16H2,1-3H3 |
| InChIKey | WKQKYEASPBXSOD-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 47.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|