About 4-[6-[2,3-bis(trifluoromethyl)phenyl]pyridazin-3-yl]morpholine
4-[6-[2,3-bis(trifluoromethyl)phenyl]pyridazin-3-yl]morpholine (PubChem CID 46226085) has the molecular formula C16H13F6N3O
and a molecular weight of 377.29 g/mol. Its IUPAC name is 4-[6-[2,3-bis(trifluoromethyl)phenyl]pyridazin-3-yl]morpholine.
Molecular Properties
| Compound Name | 4-[6-[2,3-bis(trifluoromethyl)phenyl]pyridazin-3-yl]morpholine |
| PubChem CID | 46226085 |
| Molecular Formula | C16H13F6N3O |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 4-[6-[2,3-bis(trifluoromethyl)phenyl]pyridazin-3-yl]morpholine |
| SMILES | FC(F)(F)c1cccc(-c2ccc(N3CCOCC3)nn2)c1C(F)(F)F |
| InChI | InChI=1S/C16H13F6N3O/c17-15(18,19)11-3-1-2-10(14(11)16(20,21)22)12-4-5-13(24-23-12)25-6-8-26-9-7-25/h1-5H,6-9H2 |
| InChIKey | QKSTVKQKJHYJSK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[6-[2,3-bis(trifluoromethyl)phenyl]pyridazin-3-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-[2,3-bis(trifluoromethyl)phenyl]pyridazin-3-yl]morpholine?
The IUPAC name of 4-[6-[2,3-bis(trifluoromethyl)phenyl]pyridazin-3-yl]morpholine (CID 46226085) is 4-[6-[2,3-bis(trifluoromethyl)phenyl]pyridazin-3-yl]morpholine.
What is the SMILES notation for 4-[6-[2,3-bis(trifluoromethyl)phenyl]pyridazin-3-yl]morpholine?
The canonical SMILES for 4-[6-[2,3-bis(trifluoromethyl)phenyl]pyridazin-3-yl]morpholine is FC(F)(F)c1cccc(-c2ccc(N3CCOCC3)nn2)c1C(F)(F)F.
What is the InChIKey of 4-[6-[2,3-bis(trifluoromethyl)phenyl]pyridazin-3-yl]morpholine?
The InChIKey is QKSTVKQKJHYJSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F6N3O/c17-15(18,19)11-3-1-2-10(14(11)16(20,21)22)12-4-5-13(24-23-12)25-6-8-26-9-7-25/h1-5H,6-9H2.
What are the key properties of 4-[6-[2,3-bis(trifluoromethyl)phenyl]pyridazin-3-yl]morpholine?
4-[6-[2,3-bis(trifluoromethyl)phenyl]pyridazin-3-yl]morpholine has a molecular weight of 377.29 g/mol, XLogP of 4.02, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-[2,3-bis(trifluoromethyl)phenyl]pyridazin-3-yl]morpholine is sourced from PubChem (CID 46226085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).