About 3-(1-benzofuran-2-yl)-6-[(2R,5S)-2,5-dimethylpyrrolidin-1-yl]pyridazine
3-(1-benzofuran-2-yl)-6-[(2R,5S)-2,5-dimethylpyrrolidin-1-yl]pyridazine (PubChem CID 46226113) has the molecular formula C18H19N3O
and a molecular weight of 293.37 g/mol. Its IUPAC name is 3-(1-benzofuran-2-yl)-6-[(2R,5S)-2,5-dimethylpyrrolidin-1-yl]pyridazine.
Molecular Properties
| Compound Name | 3-(1-benzofuran-2-yl)-6-[(2R,5S)-2,5-dimethylpyrrolidin-1-yl]pyridazine |
| PubChem CID | 46226113 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 3-(1-benzofuran-2-yl)-6-[(2R,5S)-2,5-dimethylpyrrolidin-1-yl]pyridazine |
| SMILES | C[C@@H]1CC[C@H](C)N1c1ccc(-c2cc3ccccc3o2)nn1 |
| InChI | InChI=1S/C18H19N3O/c1-12-7-8-13(2)21(12)18-10-9-15(19-20-18)17-11-14-5-3-4-6-16(14)22-17/h3-6,9-13H,7-8H2,1-2H3/t12-,13+ |
| InChIKey | ZBEYQVWELCVVLY-BETUJISGSA-N |
| XLogP | 4.27 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1-benzofuran-2-yl)-6-[(2R,5S)-2,5-dimethylpyrrolidin-1-yl]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-benzofuran-2-yl)-6-[(2R,5S)-2,5-dimethylpyrrolidin-1-yl]pyridazine?
The IUPAC name of 3-(1-benzofuran-2-yl)-6-[(2R,5S)-2,5-dimethylpyrrolidin-1-yl]pyridazine (CID 46226113) is 3-(1-benzofuran-2-yl)-6-[(2R,5S)-2,5-dimethylpyrrolidin-1-yl]pyridazine.
What is the SMILES notation for 3-(1-benzofuran-2-yl)-6-[(2R,5S)-2,5-dimethylpyrrolidin-1-yl]pyridazine?
The canonical SMILES for 3-(1-benzofuran-2-yl)-6-[(2R,5S)-2,5-dimethylpyrrolidin-1-yl]pyridazine is C[C@@H]1CC[C@H](C)N1c1ccc(-c2cc3ccccc3o2)nn1.
What is the InChIKey of 3-(1-benzofuran-2-yl)-6-[(2R,5S)-2,5-dimethylpyrrolidin-1-yl]pyridazine?
The InChIKey is ZBEYQVWELCVVLY-BETUJISGSA-N. The full InChI is InChI=1S/C18H19N3O/c1-12-7-8-13(2)21(12)18-10-9-15(19-20-18)17-11-14-5-3-4-6-16(14)22-17/h3-6,9-13H,7-8H2,1-2H3/t12-,13+.
What are the key properties of 3-(1-benzofuran-2-yl)-6-[(2R,5S)-2,5-dimethylpyrrolidin-1-yl]pyridazine?
3-(1-benzofuran-2-yl)-6-[(2R,5S)-2,5-dimethylpyrrolidin-1-yl]pyridazine has a molecular weight of 293.37 g/mol, XLogP of 4.27, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-benzofuran-2-yl)-6-[(2R,5S)-2,5-dimethylpyrrolidin-1-yl]pyridazine is sourced from PubChem (CID 46226113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).