C23H19Cl2F2N3S — CID 46226165
5,6-bis(4-chlorophenyl)-N-(4,4-difluorocyclohexyl)pyrazine-2-carbothioamide (PubChem CID 46226165) has the molecular formula C23H19Cl2F2N3S and a molecular weight of 478.40 g/mol. Its IUPAC name is 5,6-bis(4-chlorophenyl)-N-(4,4-difluorocyclohexyl)pyrazine-2-carbothioamide.
| Compound Name | 5,6-bis(4-chlorophenyl)-N-(4,4-difluorocyclohexyl)pyrazine-2-carbothioamide |
|---|---|
| PubChem CID | 46226165 |
| Molecular Formula | C23H19Cl2F2N3S |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | 5,6-bis(4-chlorophenyl)-N-(4,4-difluorocyclohexyl)pyrazine-2-carbothioamide |
| SMILES | FC1(F)CCC(NC(=S)c2cnc(-c3ccc(Cl)cc3)c(-c3ccc(Cl)cc3)n2)CC1 |
| InChI | InChI=1S/C23H19Cl2F2N3S/c24-16-5-1-14(2-6-16)20-21(15-3-7-17(25)8-4-15)30-19(13-28-20)22(31)29-18-9-11-23(26,27)12-10-18/h1-8,13,18H,9-12H2,(H,29,31) |
| InChIKey | AGNDHMNUEJDYLS-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|