About 1-methyl-3-octylimidazol-1-ium;octyl sulfate
1-methyl-3-octylimidazol-1-ium;octyl sulfate (PubChem CID 46226172) has the molecular formula C20H40N2O4S
and a molecular weight of 404.62 g/mol. Its IUPAC name is 1-methyl-3-octylimidazol-1-ium;octyl sulfate.
Molecular Properties
| Compound Name | 1-methyl-3-octylimidazol-1-ium;octyl sulfate |
| PubChem CID | 46226172 |
| Molecular Formula | C20H40N2O4S |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | 1-methyl-3-octylimidazol-1-ium;octyl sulfate |
| SMILES | CCCCCCCCOS(=O)(=O)[O-].CCCCCCCCn1cc[n+](C)c1 |
| InChI | InChI=1S/C12H23N2.C8H18O4S/c1-3-4-5-6-7-8-9-14-11-10-13(2)12-14;1-2-3-4-5-6-7-8-12-13(9,10)11/h10-12H,3-9H2,1-2H3;2-8H2,1H3,(H,9,10,11)/q+1;/p-1 |
| InChIKey | IDXFCXOPTUHTKE-UHFFFAOYSA-M |
| XLogP | 4.50 |
| TPSA | 75.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-octylimidazol-1-ium;octyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-octylimidazol-1-ium;octyl sulfate?
The IUPAC name of 1-methyl-3-octylimidazol-1-ium;octyl sulfate (CID 46226172) is 1-methyl-3-octylimidazol-1-ium;octyl sulfate.
What is the SMILES notation for 1-methyl-3-octylimidazol-1-ium;octyl sulfate?
The canonical SMILES for 1-methyl-3-octylimidazol-1-ium;octyl sulfate is CCCCCCCCOS(=O)(=O)[O-].CCCCCCCCn1cc[n+](C)c1.
What is the InChIKey of 1-methyl-3-octylimidazol-1-ium;octyl sulfate?
The InChIKey is IDXFCXOPTUHTKE-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H23N2.C8H18O4S/c1-3-4-5-6-7-8-9-14-11-10-13(2)12-14;1-2-3-4-5-6-7-8-12-13(9,10)11/h10-12H,3-9H2,1-2H3;2-8H2,1H3,(H,9,10,11)/q+1;/p-1.
What are the key properties of 1-methyl-3-octylimidazol-1-ium;octyl sulfate?
1-methyl-3-octylimidazol-1-ium;octyl sulfate has a molecular weight of 404.62 g/mol, XLogP of 4.50, 15 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-octylimidazol-1-ium;octyl sulfate is sourced from PubChem (CID 46226172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).