C13H12Cl2N4O — CID 46226407
4-[6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]morpholine (PubChem CID 46226407) has the molecular formula C13H12Cl2N4O and a molecular weight of 311.17 g/mol. Its IUPAC name is 4-[6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]morpholine.
| Compound Name | 4-[6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]morpholine |
|---|---|
| PubChem CID | 46226407 |
| Molecular Formula | C13H12Cl2N4O |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 4-[6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]morpholine |
| SMILES | Clc1cccc(-c2cnc(N3CCOCC3)nn2)c1Cl |
| InChI | InChI=1S/C13H12Cl2N4O/c14-10-3-1-2-9(12(10)15)11-8-16-13(18-17-11)19-4-6-20-7-5-19/h1-3,8H,4-7H2 |
| InChIKey | JPCUZGQNFRVJEY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |