About N-cyclohexyl-6-(2,3-dichlorophenyl)pyridazin-3-amine
N-cyclohexyl-6-(2,3-dichlorophenyl)pyridazin-3-amine (PubChem CID 46226430) has the molecular formula C16H17Cl2N3
and a molecular weight of 322.24 g/mol. Its IUPAC name is N-cyclohexyl-6-(2,3-dichlorophenyl)pyridazin-3-amine.
Molecular Properties
| Compound Name | N-cyclohexyl-6-(2,3-dichlorophenyl)pyridazin-3-amine |
| PubChem CID | 46226430 |
| Molecular Formula | C16H17Cl2N3 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | N-cyclohexyl-6-(2,3-dichlorophenyl)pyridazin-3-amine |
| SMILES | Clc1cccc(-c2ccc(NC3CCCCC3)nn2)c1Cl |
| InChI | InChI=1S/C16H17Cl2N3/c17-13-8-4-7-12(16(13)18)14-9-10-15(21-20-14)19-11-5-2-1-3-6-11/h4,7-11H,1-3,5-6H2,(H,19,21) |
| InChIKey | JEVAVZIQIWXBLG-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclohexyl-6-(2,3-dichlorophenyl)pyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-6-(2,3-dichlorophenyl)pyridazin-3-amine?
The IUPAC name of N-cyclohexyl-6-(2,3-dichlorophenyl)pyridazin-3-amine (CID 46226430) is N-cyclohexyl-6-(2,3-dichlorophenyl)pyridazin-3-amine.
What is the SMILES notation for N-cyclohexyl-6-(2,3-dichlorophenyl)pyridazin-3-amine?
The canonical SMILES for N-cyclohexyl-6-(2,3-dichlorophenyl)pyridazin-3-amine is Clc1cccc(-c2ccc(NC3CCCCC3)nn2)c1Cl.
What is the InChIKey of N-cyclohexyl-6-(2,3-dichlorophenyl)pyridazin-3-amine?
The InChIKey is JEVAVZIQIWXBLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17Cl2N3/c17-13-8-4-7-12(16(13)18)14-9-10-15(21-20-14)19-11-5-2-1-3-6-11/h4,7-11H,1-3,5-6H2,(H,19,21).
What are the key properties of N-cyclohexyl-6-(2,3-dichlorophenyl)pyridazin-3-amine?
N-cyclohexyl-6-(2,3-dichlorophenyl)pyridazin-3-amine has a molecular weight of 322.24 g/mol, XLogP of 5.20, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-6-(2,3-dichlorophenyl)pyridazin-3-amine is sourced from PubChem (CID 46226430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).