C10H18N6O4 — CID 46226432
ethyl 2-[[4,6-bis[hydroxy(methyl)amino]-1,3,5-triazin-2-yl]-methylamino]acetate (PubChem CID 46226432) has the molecular formula C10H18N6O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is ethyl 2-[[4,6-bis[hydroxy(methyl)amino]-1,3,5-triazin-2-yl]-methylamino]acetate.
| Compound Name | ethyl 2-[[4,6-bis[hydroxy(methyl)amino]-1,3,5-triazin-2-yl]-methylamino]acetate |
|---|---|
| PubChem CID | 46226432 |
| Molecular Formula | C10H18N6O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | ethyl 2-[[4,6-bis[hydroxy(methyl)amino]-1,3,5-triazin-2-yl]-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)c1nc(N(C)O)nc(N(C)O)n1 |
| InChI | InChI=1S/C10H18N6O4/c1-5-20-7(17)6-14(2)8-11-9(15(3)18)13-10(12-8)16(4)19/h18-19H,5-6H2,1-4H3 |
| InChIKey | CNPLFKGWJMQVDU-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|