C23H33N3O2S2 — CID 46226493
2-[1-[5-(dithiolan-3-yl)pentyl]triazol-4-yl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol (PubChem CID 46226493) has the molecular formula C23H33N3O2S2 and a molecular weight of 447.67 g/mol. Its IUPAC name is 2-[1-[5-(dithiolan-3-yl)pentyl]triazol-4-yl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol.
| Compound Name | 2-[1-[5-(dithiolan-3-yl)pentyl]triazol-4-yl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 46226493 |
| Molecular Formula | C23H33N3O2S2 |
| Molecular Weight | 447.67 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 2-[1-[5-(dithiolan-3-yl)pentyl]triazol-4-yl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(c1cn(CCCCCC3CCSS3)nn1)O2 |
| InChI | InChI=1S/C23H33N3O2S2/c1-15-16(2)22-19(17(3)21(15)27)9-11-23(4,28-22)20-14-26(25-24-20)12-7-5-6-8-18-10-13-29-30-18/h14,18,27H,5-13H2,1-4H3 |
| InChIKey | ZEDKBOBHQDEJEE-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.67 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|