About 2-methoxy-5-[(2,3,4-trimethoxyphenyl)methyl]aniline
2-methoxy-5-[(2,3,4-trimethoxyphenyl)methyl]aniline (PubChem CID 46226508) has the molecular formula C17H21NO4
and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-methoxy-5-[(2,3,4-trimethoxyphenyl)methyl]aniline.
Molecular Properties
| Compound Name | 2-methoxy-5-[(2,3,4-trimethoxyphenyl)methyl]aniline |
| PubChem CID | 46226508 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 2-methoxy-5-[(2,3,4-trimethoxyphenyl)methyl]aniline |
| SMILES | COc1ccc(Cc2ccc(OC)c(OC)c2OC)cc1N |
| InChI | InChI=1S/C17H21NO4/c1-19-14-7-5-11(10-13(14)18)9-12-6-8-15(20-2)17(22-4)16(12)21-3/h5-8,10H,9,18H2,1-4H3 |
| InChIKey | DRQWJTIHAHFXLM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-5-[(2,3,4-trimethoxyphenyl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-5-[(2,3,4-trimethoxyphenyl)methyl]aniline?
The IUPAC name of 2-methoxy-5-[(2,3,4-trimethoxyphenyl)methyl]aniline (CID 46226508) is 2-methoxy-5-[(2,3,4-trimethoxyphenyl)methyl]aniline.
What is the SMILES notation for 2-methoxy-5-[(2,3,4-trimethoxyphenyl)methyl]aniline?
The canonical SMILES for 2-methoxy-5-[(2,3,4-trimethoxyphenyl)methyl]aniline is COc1ccc(Cc2ccc(OC)c(OC)c2OC)cc1N.
What is the InChIKey of 2-methoxy-5-[(2,3,4-trimethoxyphenyl)methyl]aniline?
The InChIKey is DRQWJTIHAHFXLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO4/c1-19-14-7-5-11(10-13(14)18)9-12-6-8-15(20-2)17(22-4)16(12)21-3/h5-8,10H,9,18H2,1-4H3.
What are the key properties of 2-methoxy-5-[(2,3,4-trimethoxyphenyl)methyl]aniline?
2-methoxy-5-[(2,3,4-trimethoxyphenyl)methyl]aniline has a molecular weight of 303.36 g/mol, XLogP of 2.89, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-5-[(2,3,4-trimethoxyphenyl)methyl]aniline is sourced from PubChem (CID 46226508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).