About 4-[5-(4-iodophenyl)-1,3,4-oxadiazol-2-yl]-N,N-dimethylaniline
4-[5-(4-iodophenyl)-1,3,4-oxadiazol-2-yl]-N,N-dimethylaniline (PubChem CID 46227020) has the molecular formula C16H14IN3O
and a molecular weight of 391.21 g/mol. Its IUPAC name is 4-[5-(4-iodophenyl)-1,3,4-oxadiazol-2-yl]-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 4-[5-(4-iodophenyl)-1,3,4-oxadiazol-2-yl]-N,N-dimethylaniline |
| PubChem CID | 46227020 |
| Molecular Formula | C16H14IN3O |
| Molecular Weight | 391.21 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | 4-[5-(4-iodophenyl)-1,3,4-oxadiazol-2-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2nnc(-c3ccc(I)cc3)o2)cc1 |
| InChI | InChI=1S/C16H14IN3O/c1-20(2)14-9-5-12(6-10-14)16-19-18-15(21-16)11-3-7-13(17)8-4-11/h3-10H,1-2H3 |
| InChIKey | DQBPGZXXICPELN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.21 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-(4-iodophenyl)-1,3,4-oxadiazol-2-yl]-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(4-iodophenyl)-1,3,4-oxadiazol-2-yl]-N,N-dimethylaniline?
The IUPAC name of 4-[5-(4-iodophenyl)-1,3,4-oxadiazol-2-yl]-N,N-dimethylaniline (CID 46227020) is 4-[5-(4-iodophenyl)-1,3,4-oxadiazol-2-yl]-N,N-dimethylaniline.
What is the SMILES notation for 4-[5-(4-iodophenyl)-1,3,4-oxadiazol-2-yl]-N,N-dimethylaniline?
The canonical SMILES for 4-[5-(4-iodophenyl)-1,3,4-oxadiazol-2-yl]-N,N-dimethylaniline is CN(C)c1ccc(-c2nnc(-c3ccc(I)cc3)o2)cc1.
What is the InChIKey of 4-[5-(4-iodophenyl)-1,3,4-oxadiazol-2-yl]-N,N-dimethylaniline?
The InChIKey is DQBPGZXXICPELN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14IN3O/c1-20(2)14-9-5-12(6-10-14)16-19-18-15(21-16)11-3-7-13(17)8-4-11/h3-10H,1-2H3.
What are the key properties of 4-[5-(4-iodophenyl)-1,3,4-oxadiazol-2-yl]-N,N-dimethylaniline?
4-[5-(4-iodophenyl)-1,3,4-oxadiazol-2-yl]-N,N-dimethylaniline has a molecular weight of 391.21 g/mol, XLogP of 4.07, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(4-iodophenyl)-1,3,4-oxadiazol-2-yl]-N,N-dimethylaniline is sourced from PubChem (CID 46227020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).