C34H27BrO11 — CID 46227032
[3-(4-hydroxy-3-methoxyphenyl)-6-[(2R,3R)-3,5,7-trihydroxy-4-oxo-2,3-dihydrochromen-2-yl]-2,3-dihydro-1,4-benzodioxin-2-yl]methyl (E)-3-(4-bromophenyl)prop-2-enoate (PubChem CID 46227032) has the molecular formula C34H27BrO11 and a molecular weight of 691.48 g/mol. Its IUPAC name is [3-(4-hydroxy-3-methoxyphenyl)-6-[(2R,3R)-3,5,7-trihydroxy-4-oxo-2,3-dihydrochromen-2-yl]-2,3-dihydro-1,4-benzodioxin-2-yl]methyl (E)-3-(4-bromophenyl)prop-2-enoate.
| Compound Name | [3-(4-hydroxy-3-methoxyphenyl)-6-[(2R,3R)-3,5,7-trihydroxy-4-oxo-2,3-dihydrochromen-2-yl]-2,3-dihydro-1,4-benzodioxin-2-yl]methyl (E)-3-(4-bromophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 46227032 |
| Molecular Formula | C34H27BrO11 |
| Molecular Weight | 691.48 g/mol |
| Exact Mass | 690.07 |
| IUPAC Name | [3-(4-hydroxy-3-methoxyphenyl)-6-[(2R,3R)-3,5,7-trihydroxy-4-oxo-2,3-dihydrochromen-2-yl]-2,3-dihydro-1,4-benzodioxin-2-yl]methyl (E)-3-(4-bromophenyl)prop-2-enoate |
| SMILES | COc1cc(C2Oc3cc([C@H]4Oc5cc(O)cc(O)c5C(=O)[C@@H]4O)ccc3OC2COC(=O)/C=C/c2ccc(Br)cc2)ccc1O |
| InChI | InChI=1S/C34H27BrO11/c1-42-25-12-18(5-9-22(25)37)33-28(16-43-29(39)11-4-17-2-7-20(35)8-3-17)44-24-10-6-19(13-26(24)45-33)34-32(41)31(40)30-23(38)14-21(36)15-27(30)46-34/h2-15,28,32-34,36-38,41H,16H2,1H3/b11-4+/t28?,32-,33?,34+/m0/s1 |
| InChIKey | QUAHYMIICWUAJI-LMBBNVNZSA-N |
| XLogP | 5.39 |
| TPSA | 161.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.48 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|