C23H21F2N5O — CID 46227245
7-[(3,5-difluorophenyl)methyl]-N-(4-morpholin-4-ylphenyl)pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 46227245) has the molecular formula C23H21F2N5O and a molecular weight of 421.45 g/mol. Its IUPAC name is 7-[(3,5-difluorophenyl)methyl]-N-(4-morpholin-4-ylphenyl)pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 7-[(3,5-difluorophenyl)methyl]-N-(4-morpholin-4-ylphenyl)pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 46227245 |
| Molecular Formula | C23H21F2N5O |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 7-[(3,5-difluorophenyl)methyl]-N-(4-morpholin-4-ylphenyl)pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | Fc1cc(F)cc(Cn2ccc3cnc(Nc4ccc(N5CCOCC5)cc4)nc32)c1 |
| InChI | InChI=1S/C23H21F2N5O/c24-18-11-16(12-19(25)13-18)15-30-6-5-17-14-26-23(28-22(17)30)27-20-1-3-21(4-2-20)29-7-9-31-10-8-29/h1-6,11-14H,7-10,15H2,(H,26,27,28) |
| InChIKey | BKXBJRBGRSFVLX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|