C25H24F2N6O2 — CID 46227277
2-[4-[4-[[7-[(3,5-difluorophenyl)methyl]pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]acetic acid (PubChem CID 46227277) has the molecular formula C25H24F2N6O2 and a molecular weight of 478.50 g/mol. Its IUPAC name is 2-[4-[4-[[7-[(3,5-difluorophenyl)methyl]pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[4-[[7-[(3,5-difluorophenyl)methyl]pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 46227277 |
| Molecular Formula | C25H24F2N6O2 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 2-[4-[4-[[7-[(3,5-difluorophenyl)methyl]pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(c2ccc(Nc3ncc4ccn(Cc5cc(F)cc(F)c5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C25H24F2N6O2/c26-19-11-17(12-20(27)13-19)15-33-6-5-18-14-28-25(30-24(18)33)29-21-1-3-22(4-2-21)32-9-7-31(8-10-32)16-23(34)35/h1-6,11-14H,7-10,15-16H2,(H,34,35)(H,28,29,30) |
| InChIKey | NDGVHMLPQLCZGY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|