C26H12Br2N6O5 — CID 46227296
14,16-dibromo-3,5-bis(4-nitrophenyl)-6,8,10,18-tetrazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2(7),3,5,8,12(17),13,15-octaen-11-one (PubChem CID 46227296) has the molecular formula C26H12Br2N6O5 and a molecular weight of 648.23 g/mol. Its IUPAC name is 14,16-dibromo-3,5-bis(4-nitrophenyl)-6,8,10,18-tetrazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2(7),3,5,8,12(17),13,15-octaen-11-one.
| Compound Name | 14,16-dibromo-3,5-bis(4-nitrophenyl)-6,8,10,18-tetrazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2(7),3,5,8,12(17),13,15-octaen-11-one |
|---|---|
| PubChem CID | 46227296 |
| Molecular Formula | C26H12Br2N6O5 |
| Molecular Weight | 648.23 g/mol |
| Exact Mass | 645.92 |
| IUPAC Name | 14,16-dibromo-3,5-bis(4-nitrophenyl)-6,8,10,18-tetrazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2(7),3,5,8,12(17),13,15-octaen-11-one |
| SMILES | O=c1c2cc(Br)cc(Br)c2nc2c3c(-c4ccc([N+](=O)[O-])cc4)cc(-c4ccc([N+](=O)[O-])cc4)nc3ncn12 |
| InChI | InChI=1S/C26H12Br2N6O5/c27-15-9-19-23(20(28)10-15)31-25-22-18(13-1-5-16(6-2-13)33(36)37)11-21(14-3-7-17(8-4-14)34(38)39)30-24(22)29-12-32(25)26(19)35/h1-12H |
| InChIKey | FEBZDCBKEUAYJN-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 146.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.23 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|