C27H16Br2N4O — CID 46227330
14,16-dibromo-3-(4-methylphenyl)-5-phenyl-6,8,10,18-tetrazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2(7),3,5,8,12(17),13,15-octaen-11-one (PubChem CID 46227330) has the molecular formula C27H16Br2N4O and a molecular weight of 572.26 g/mol. Its IUPAC name is 14,16-dibromo-3-(4-methylphenyl)-5-phenyl-6,8,10,18-tetrazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2(7),3,5,8,12(17),13,15-octaen-11-one.
| Compound Name | 14,16-dibromo-3-(4-methylphenyl)-5-phenyl-6,8,10,18-tetrazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2(7),3,5,8,12(17),13,15-octaen-11-one |
|---|---|
| PubChem CID | 46227330 |
| Molecular Formula | C27H16Br2N4O |
| Molecular Weight | 572.26 g/mol |
| Exact Mass | 569.97 |
| IUPAC Name | 14,16-dibromo-3-(4-methylphenyl)-5-phenyl-6,8,10,18-tetrazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2(7),3,5,8,12(17),13,15-octaen-11-one |
| SMILES | Cc1ccc(-c2cc(-c3ccccc3)nc3ncn4c(=O)c5cc(Br)cc(Br)c5nc4c23)cc1 |
| InChI | InChI=1S/C27H16Br2N4O/c1-15-7-9-16(10-8-15)19-13-22(17-5-3-2-4-6-17)31-25-23(19)26-32-24-20(11-18(28)12-21(24)29)27(34)33(26)14-30-25/h2-14H,1H3 |
| InChIKey | XWZBSPTWPWGAEK-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 60.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.26 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|