C20H29N5O5 — CID 46227372
(2R,3R,4R,5S)-2-(hydroxymethyl)-5-[4-[[4-(4-methylpiperazin-1-yl)phenoxy]methyl]triazol-1-yl]oxane-3,4-diol (PubChem CID 46227372) has the molecular formula C20H29N5O5 and a molecular weight of 419.48 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(hydroxymethyl)-5-[4-[[4-(4-methylpiperazin-1-yl)phenoxy]methyl]triazol-1-yl]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-5-[4-[[4-(4-methylpiperazin-1-yl)phenoxy]methyl]triazol-1-yl]oxane-3,4-diol |
|---|---|
| PubChem CID | 46227372 |
| Molecular Formula | C20H29N5O5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-5-[4-[[4-(4-methylpiperazin-1-yl)phenoxy]methyl]triazol-1-yl]oxane-3,4-diol |
| SMILES | CN1CCN(c2ccc(OCc3cn([C@H]4CO[C@H](CO)[C@H](O)[C@@H]4O)nn3)cc2)CC1 |
| InChI | InChI=1S/C20H29N5O5/c1-23-6-8-24(9-7-23)15-2-4-16(5-3-15)29-12-14-10-25(22-21-14)17-13-30-18(11-26)20(28)19(17)27/h2-5,10,17-20,26-28H,6-9,11-13H2,1H3/t17-,18+,19+,20-/m0/s1 |
| InChIKey | XCYXJGAEWFGLIL-NMLBUPMWSA-N |
| XLogP | -0.74 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|