C16H20N6 — CID 46227409
4-N,7-N-bis(2-aminoethyl)-1,10-phenanthroline-4,7-diamine (PubChem CID 46227409) has the molecular formula C16H20N6 and a molecular weight of 296.38 g/mol. Its IUPAC name is 4-N,7-N-bis(2-aminoethyl)-1,10-phenanthroline-4,7-diamine.
| Compound Name | 4-N,7-N-bis(2-aminoethyl)-1,10-phenanthroline-4,7-diamine |
|---|---|
| PubChem CID | 46227409 |
| Molecular Formula | C16H20N6 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 4-N,7-N-bis(2-aminoethyl)-1,10-phenanthroline-4,7-diamine |
| SMILES | NCCNc1ccnc2c1ccc1c(NCCN)ccnc12 |
| InChI | InChI=1S/C16H20N6/c17-5-9-19-13-3-7-21-15-11(13)1-2-12-14(20-10-6-18)4-8-22-16(12)15/h1-4,7-8H,5-6,9-10,17-18H2,(H,19,21)(H,20,22) |
| InChIKey | GBNDRIVALDKOLH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|