C25H25NO4S — CID 46227530
bis(prop-2-enyl) 2,6-dimethyl-4-(4-phenylthiophen-2-yl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 46227530) has the molecular formula C25H25NO4S and a molecular weight of 435.55 g/mol. Its IUPAC name is bis(prop-2-enyl) 2,6-dimethyl-4-(4-phenylthiophen-2-yl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis(prop-2-enyl) 2,6-dimethyl-4-(4-phenylthiophen-2-yl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 46227530 |
| Molecular Formula | C25H25NO4S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | bis(prop-2-enyl) 2,6-dimethyl-4-(4-phenylthiophen-2-yl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | C=CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC=C)C1c1cc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C25H25NO4S/c1-5-12-29-24(27)21-16(3)26-17(4)22(25(28)30-13-6-2)23(21)20-14-19(15-31-20)18-10-8-7-9-11-18/h5-11,14-15,23,26H,1-2,12-13H2,3-4H3 |
| InChIKey | CYRRBQKCXWDLQE-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|