C26H24N2O2 — CID 46227679
benzyl 1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 46227679) has the molecular formula C26H24N2O2 and a molecular weight of 396.49 g/mol. Its IUPAC name is benzyl 1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | benzyl 1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 46227679 |
| Molecular Formula | C26H24N2O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | benzyl 1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | Cc1ccc(C2c3[nH]c4ccccc4c3CCN2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H24N2O2/c1-18-11-13-20(14-12-18)25-24-22(21-9-5-6-10-23(21)27-24)15-16-28(25)26(29)30-17-19-7-3-2-4-8-19/h2-14,25,27H,15-17H2,1H3 |
| InChIKey | NBTPZQDEPHHPRO-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|