C40H40N2O8 — CID 46227737
5-[(E)-2-[4-[(1E,3E)-4-[4-[(E)-2-(3,5-dimethyl-4-nitrophenyl)ethenyl]-2,5-dimethoxyphenyl]buta-1,3-dienyl]-2,5-dimethoxyphenyl]ethenyl]-1,3-dimethyl-2-nitrobenzene (PubChem CID 46227737) has the molecular formula C40H40N2O8 and a molecular weight of 676.77 g/mol. Its IUPAC name is 5-[(E)-2-[4-[(1E,3E)-4-[4-[(E)-2-(3,5-dimethyl-4-nitrophenyl)ethenyl]-2,5-dimethoxyphenyl]buta-1,3-dienyl]-2,5-dimethoxyphenyl]ethenyl]-1,3-dimethyl-2-nitrobenzene.
| Compound Name | 5-[(E)-2-[4-[(1E,3E)-4-[4-[(E)-2-(3,5-dimethyl-4-nitrophenyl)ethenyl]-2,5-dimethoxyphenyl]buta-1,3-dienyl]-2,5-dimethoxyphenyl]ethenyl]-1,3-dimethyl-2-nitrobenzene |
|---|---|
| PubChem CID | 46227737 |
| Molecular Formula | C40H40N2O8 |
| Molecular Weight | 676.77 g/mol |
| Exact Mass | 676.28 |
| IUPAC Name | 5-[(E)-2-[4-[(1E,3E)-4-[4-[(E)-2-(3,5-dimethyl-4-nitrophenyl)ethenyl]-2,5-dimethoxyphenyl]buta-1,3-dienyl]-2,5-dimethoxyphenyl]ethenyl]-1,3-dimethyl-2-nitrobenzene |
| SMILES | COc1cc(/C=C/c2cc(C)c([N+](=O)[O-])c(C)c2)c(OC)cc1/C=C/C=C/c1cc(OC)c(/C=C/c2cc(C)c([N+](=O)[O-])c(C)c2)cc1OC |
| InChI | InChI=1S/C40H40N2O8/c1-25-17-29(18-26(2)39(25)41(43)44)13-15-33-23-35(47-5)31(21-37(33)49-7)11-9-10-12-32-22-38(50-8)34(24-36(32)48-6)16-14-30-19-27(3)40(42(45)46)28(4)20-30/h9-24H,1-8H3/b11-9+,12-10+,15-13+,16-14+ |
| InChIKey | ZIMZVNKGECPTFI-UYFZKRQQSA-N |
| XLogP | 9.84 |
| TPSA | 123.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.77 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|