C24H26FN3O2 — CID 46227757
9-[3-(5-fluoro-1H-indol-3-yl)propyl-methylamino]-2,3,4,8,9,10-hexahydropyrano[2,3-h]isoquinolin-1-one (PubChem CID 46227757) has the molecular formula C24H26FN3O2 and a molecular weight of 407.49 g/mol. Its IUPAC name is 9-[3-(5-fluoro-1H-indol-3-yl)propyl-methylamino]-2,3,4,8,9,10-hexahydropyrano[2,3-h]isoquinolin-1-one.
| Compound Name | 9-[3-(5-fluoro-1H-indol-3-yl)propyl-methylamino]-2,3,4,8,9,10-hexahydropyrano[2,3-h]isoquinolin-1-one |
|---|---|
| PubChem CID | 46227757 |
| Molecular Formula | C24H26FN3O2 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 9-[3-(5-fluoro-1H-indol-3-yl)propyl-methylamino]-2,3,4,8,9,10-hexahydropyrano[2,3-h]isoquinolin-1-one |
| SMILES | CN(CCCc1c[nH]c2ccc(F)cc12)C1COc2ccc3c(c2C1)C(=O)NCC3 |
| InChI | InChI=1S/C24H26FN3O2/c1-28(10-2-3-16-13-27-21-6-5-17(25)11-19(16)21)18-12-20-22(30-14-18)7-4-15-8-9-26-24(29)23(15)20/h4-7,11,13,18,27H,2-3,8-10,12,14H2,1H3,(H,26,29) |
| InChIKey | KMLCAXOEHCQJRO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |