C25H28FN3O2 — CID 46227770
9-[ethyl-[3-(5-fluoro-1H-indol-3-yl)propyl]amino]-2,3,4,8,9,10-hexahydropyrano[2,3-h]isoquinolin-1-one (PubChem CID 46227770) has the molecular formula C25H28FN3O2 and a molecular weight of 421.52 g/mol. Its IUPAC name is 9-[ethyl-[3-(5-fluoro-1H-indol-3-yl)propyl]amino]-2,3,4,8,9,10-hexahydropyrano[2,3-h]isoquinolin-1-one.
| Compound Name | 9-[ethyl-[3-(5-fluoro-1H-indol-3-yl)propyl]amino]-2,3,4,8,9,10-hexahydropyrano[2,3-h]isoquinolin-1-one |
|---|---|
| PubChem CID | 46227770 |
| Molecular Formula | C25H28FN3O2 |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 9-[ethyl-[3-(5-fluoro-1H-indol-3-yl)propyl]amino]-2,3,4,8,9,10-hexahydropyrano[2,3-h]isoquinolin-1-one |
| SMILES | CCN(CCCc1c[nH]c2ccc(F)cc12)C1COc2ccc3c(c2C1)C(=O)NCC3 |
| InChI | InChI=1S/C25H28FN3O2/c1-2-29(11-3-4-17-14-28-22-7-6-18(26)12-20(17)22)19-13-21-23(31-15-19)8-5-16-9-10-27-25(30)24(16)21/h5-8,12,14,19,28H,2-4,9-11,13,15H2,1H3,(H,27,30) |
| InChIKey | GSAFRMKQXDFZBL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |