About 1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,4-diene
1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,4-diene (PubChem CID 46227843) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,4-diene.
Analyze 1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,4-diene?
The IUPAC name of 1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,4-diene (CID 46227843) is 1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,4-diene.
What is the SMILES notation for 1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,4-diene?
The canonical SMILES for 1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,4-diene is CC12CCC(C3C=NN=C31)C2(C)C.
What is the InChIKey of 1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,4-diene?
The InChIKey is FCCSMIOXGMZIRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-10(2)8-4-5-11(10,3)9-7(8)6-12-13-9/h6-8H,4-5H2,1-3H3.
What are the key properties of 1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,4-diene?
1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,4-diene has a molecular weight of 176.26 g/mol, XLogP of 2.50, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,4-diene is sourced from PubChem (CID 46227843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).