C14H26O8S — CID 46227854
(2S,3R,4S,5R)-2-[(2R,3R,5R,6S)-5-hydroxy-2-(hydroxymethyl)-6-propan-2-yloxyoxan-3-yl]sulfanyloxane-3,4,5-triol (PubChem CID 46227854) has the molecular formula C14H26O8S and a molecular weight of 354.42 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-[(2R,3R,5R,6S)-5-hydroxy-2-(hydroxymethyl)-6-propan-2-yloxyoxan-3-yl]sulfanyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R)-2-[(2R,3R,5R,6S)-5-hydroxy-2-(hydroxymethyl)-6-propan-2-yloxyoxan-3-yl]sulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 46227854 |
| Molecular Formula | C14H26O8S |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | (2S,3R,4S,5R)-2-[(2R,3R,5R,6S)-5-hydroxy-2-(hydroxymethyl)-6-propan-2-yloxyoxan-3-yl]sulfanyloxane-3,4,5-triol |
| SMILES | CC(C)O[C@H]1O[C@H](CO)[C@H](S[C@@H]2OC[C@@H](O)[C@H](O)[C@H]2O)C[C@H]1O |
| InChI | InChI=1S/C14H26O8S/c1-6(2)21-13-7(16)3-10(9(4-15)22-13)23-14-12(19)11(18)8(17)5-20-14/h6-19H,3-5H2,1-2H3/t7-,8-,9-,10-,11+,12-,13+,14+/m1/s1 |
| InChIKey | VEMLOLXADZNJCR-LDIBXLSFSA-N |
| XLogP | -1.58 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |