C20H14F2N4O3 — CID 46227950
8-[(2,6-difluorophenyl)methyl]-3-(furan-2-ylmethyl)-1-prop-2-ynyl-7H-purine-2,6-dione (PubChem CID 46227950) has the molecular formula C20H14F2N4O3 and a molecular weight of 396.35 g/mol. Its IUPAC name is 8-[(2,6-difluorophenyl)methyl]-3-(furan-2-ylmethyl)-1-prop-2-ynyl-7H-purine-2,6-dione.
| Compound Name | 8-[(2,6-difluorophenyl)methyl]-3-(furan-2-ylmethyl)-1-prop-2-ynyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 46227950 |
| Molecular Formula | C20H14F2N4O3 |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 8-[(2,6-difluorophenyl)methyl]-3-(furan-2-ylmethyl)-1-prop-2-ynyl-7H-purine-2,6-dione |
| SMILES | C#CCn1c(=O)c2[nH]c(Cc3c(F)cccc3F)nc2n(Cc2ccco2)c1=O |
| InChI | InChI=1S/C20H14F2N4O3/c1-2-8-25-19(27)17-18(26(20(25)28)11-12-5-4-9-29-12)24-16(23-17)10-13-14(21)6-3-7-15(13)22/h1,3-7,9H,8,10-11H2,(H,23,24) |
| InChIKey | XGTLPGBZBAYREK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 85.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|