About 8-[(2,6-difluorophenyl)methyl]-3-(furan-2-ylmethyl)-7-methyl-1-prop-2-enylpurine-2,6-dione
8-[(2,6-difluorophenyl)methyl]-3-(furan-2-ylmethyl)-7-methyl-1-prop-2-enylpurine-2,6-dione (PubChem CID 46227952) has the molecular formula C21H18F2N4O3
and a molecular weight of 412.40 g/mol. Its IUPAC name is 8-[(2,6-difluorophenyl)methyl]-3-(furan-2-ylmethyl)-7-methyl-1-prop-2-enylpurine-2,6-dione.
Molecular Properties
| Compound Name | 8-[(2,6-difluorophenyl)methyl]-3-(furan-2-ylmethyl)-7-methyl-1-prop-2-enylpurine-2,6-dione |
| PubChem CID | 46227952 |
| Molecular Formula | C21H18F2N4O3 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 8-[(2,6-difluorophenyl)methyl]-3-(furan-2-ylmethyl)-7-methyl-1-prop-2-enylpurine-2,6-dione |
| SMILES | C=CCn1c(=O)c2c(nc(Cc3c(F)cccc3F)n2C)n(Cc2ccco2)c1=O |
| InChI | InChI=1S/C21H18F2N4O3/c1-3-9-26-20(28)18-19(27(21(26)29)12-13-6-5-10-30-13)24-17(25(18)2)11-14-15(22)7-4-8-16(14)23/h3-8,10H,1,9,11-12H2,2H3 |
| InChIKey | LIMBCJHHZJITSJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 74.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-[(2,6-difluorophenyl)methyl]-3-(furan-2-ylmethyl)-7-methyl-1-prop-2-enylpurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(2,6-difluorophenyl)methyl]-3-(furan-2-ylmethyl)-7-methyl-1-prop-2-enylpurine-2,6-dione?
The IUPAC name of 8-[(2,6-difluorophenyl)methyl]-3-(furan-2-ylmethyl)-7-methyl-1-prop-2-enylpurine-2,6-dione (CID 46227952) is 8-[(2,6-difluorophenyl)methyl]-3-(furan-2-ylmethyl)-7-methyl-1-prop-2-enylpurine-2,6-dione.
What is the SMILES notation for 8-[(2,6-difluorophenyl)methyl]-3-(furan-2-ylmethyl)-7-methyl-1-prop-2-enylpurine-2,6-dione?
The canonical SMILES for 8-[(2,6-difluorophenyl)methyl]-3-(furan-2-ylmethyl)-7-methyl-1-prop-2-enylpurine-2,6-dione is C=CCn1c(=O)c2c(nc(Cc3c(F)cccc3F)n2C)n(Cc2ccco2)c1=O.
What is the InChIKey of 8-[(2,6-difluorophenyl)methyl]-3-(furan-2-ylmethyl)-7-methyl-1-prop-2-enylpurine-2,6-dione?
The InChIKey is LIMBCJHHZJITSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18F2N4O3/c1-3-9-26-20(28)18-19(27(21(26)29)12-13-6-5-10-30-13)24-17(25(18)2)11-14-15(22)7-4-8-16(14)23/h3-8,10H,1,9,11-12H2,2H3.
What are the key properties of 8-[(2,6-difluorophenyl)methyl]-3-(furan-2-ylmethyl)-7-methyl-1-prop-2-enylpurine-2,6-dione?
8-[(2,6-difluorophenyl)methyl]-3-(furan-2-ylmethyl)-7-methyl-1-prop-2-enylpurine-2,6-dione has a molecular weight of 412.40 g/mol, XLogP of 2.59, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(2,6-difluorophenyl)methyl]-3-(furan-2-ylmethyl)-7-methyl-1-prop-2-enylpurine-2,6-dione is sourced from PubChem (CID 46227952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).