About 3-(furan-2-ylmethyl)-7-methyl-1-propyl-8-(thiophen-2-ylmethyl)purine-2,6-dione
3-(furan-2-ylmethyl)-7-methyl-1-propyl-8-(thiophen-2-ylmethyl)purine-2,6-dione (PubChem CID 46228058) has the molecular formula C19H20N4O3S
and a molecular weight of 384.46 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-7-methyl-1-propyl-8-(thiophen-2-ylmethyl)purine-2,6-dione.
Molecular Properties
| Compound Name | 3-(furan-2-ylmethyl)-7-methyl-1-propyl-8-(thiophen-2-ylmethyl)purine-2,6-dione |
| PubChem CID | 46228058 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 3-(furan-2-ylmethyl)-7-methyl-1-propyl-8-(thiophen-2-ylmethyl)purine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(nc(Cc3cccs3)n2C)n(Cc2ccco2)c1=O |
| InChI | InChI=1S/C19H20N4O3S/c1-3-8-22-18(24)16-17(23(19(22)25)12-13-6-4-9-26-13)20-15(21(16)2)11-14-7-5-10-27-14/h4-7,9-10H,3,8,11-12H2,1-2H3 |
| InChIKey | MHAUZMSHZITGEY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 74.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-(furan-2-ylmethyl)-7-methyl-1-propyl-8-(thiophen-2-ylmethyl)purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(furan-2-ylmethyl)-7-methyl-1-propyl-8-(thiophen-2-ylmethyl)purine-2,6-dione?
The IUPAC name of 3-(furan-2-ylmethyl)-7-methyl-1-propyl-8-(thiophen-2-ylmethyl)purine-2,6-dione (CID 46228058) is 3-(furan-2-ylmethyl)-7-methyl-1-propyl-8-(thiophen-2-ylmethyl)purine-2,6-dione.
What is the SMILES notation for 3-(furan-2-ylmethyl)-7-methyl-1-propyl-8-(thiophen-2-ylmethyl)purine-2,6-dione?
The canonical SMILES for 3-(furan-2-ylmethyl)-7-methyl-1-propyl-8-(thiophen-2-ylmethyl)purine-2,6-dione is CCCn1c(=O)c2c(nc(Cc3cccs3)n2C)n(Cc2ccco2)c1=O.
What is the InChIKey of 3-(furan-2-ylmethyl)-7-methyl-1-propyl-8-(thiophen-2-ylmethyl)purine-2,6-dione?
The InChIKey is MHAUZMSHZITGEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O3S/c1-3-8-22-18(24)16-17(23(19(22)25)12-13-6-4-9-26-13)20-15(21(16)2)11-14-7-5-10-27-14/h4-7,9-10H,3,8,11-12H2,1-2H3.
What are the key properties of 3-(furan-2-ylmethyl)-7-methyl-1-propyl-8-(thiophen-2-ylmethyl)purine-2,6-dione?
3-(furan-2-ylmethyl)-7-methyl-1-propyl-8-(thiophen-2-ylmethyl)purine-2,6-dione has a molecular weight of 384.46 g/mol, XLogP of 2.60, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(furan-2-ylmethyl)-7-methyl-1-propyl-8-(thiophen-2-ylmethyl)purine-2,6-dione is sourced from PubChem (CID 46228058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).