C9H16N2O7 — CID 46228147
(8R,9S,10S,11R)-2,9,10,11-tetrahydroxy-8-(hydroxymethyl)-7-oxa-1,4-diazaspiro[5.5]undecan-5-one (PubChem CID 46228147) has the molecular formula C9H16N2O7 and a molecular weight of 264.23 g/mol. Its IUPAC name is (8R,9S,10S,11R)-2,9,10,11-tetrahydroxy-8-(hydroxymethyl)-7-oxa-1,4-diazaspiro[5.5]undecan-5-one.
| Compound Name | (8R,9S,10S,11R)-2,9,10,11-tetrahydroxy-8-(hydroxymethyl)-7-oxa-1,4-diazaspiro[5.5]undecan-5-one |
|---|---|
| PubChem CID | 46228147 |
| Molecular Formula | C9H16N2O7 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (8R,9S,10S,11R)-2,9,10,11-tetrahydroxy-8-(hydroxymethyl)-7-oxa-1,4-diazaspiro[5.5]undecan-5-one |
| SMILES | O=C1NCC(O)NC12O[C@H](CO)[C@@H](O)[C@H](O)C2O |
| InChI | InChI=1S/C9H16N2O7/c12-2-3-5(14)6(15)7(16)9(18-3)8(17)10-1-4(13)11-9/h3-7,11-16H,1-2H2,(H,10,17)/t3-,4?,5-,6+,7?,9?/m1/s1 |
| InChIKey | PDBGJSFWRCBNGD-WYCIZOITSA-N |
| XLogP | -4.81 |
| TPSA | 151.51 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | -4.81 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |