C15H14O4 — CID 46228186
(1R,3S)-9-hydroxy-1,3-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione (PubChem CID 46228186) has the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. Its IUPAC name is (1R,3S)-9-hydroxy-1,3-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione.
| Compound Name | (1R,3S)-9-hydroxy-1,3-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione |
|---|---|
| PubChem CID | 46228186 |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | (1R,3S)-9-hydroxy-1,3-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione |
| SMILES | C[C@H]1CC2=C(C(=O)c3c(O)cccc3C2=O)[C@@H](C)O1 |
| InChI | InChI=1S/C15H14O4/c1-7-6-10-12(8(2)19-7)15(18)13-9(14(10)17)4-3-5-11(13)16/h3-5,7-8,16H,6H2,1-2H3/t7-,8+/m0/s1 |
| InChIKey | PPEBHGFEKAUPBT-JGVFFNPUSA-N |
| XLogP | 2.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|