C19H26N4 — CID 46228418
2-N-benzyl-4-N-cyclohexyl-2-N,6-dimethylpyrimidine-2,4-diamine (PubChem CID 46228418) has the molecular formula C19H26N4 and a molecular weight of 310.44 g/mol. Its IUPAC name is 2-N-benzyl-4-N-cyclohexyl-2-N,6-dimethylpyrimidine-2,4-diamine.
| Compound Name | 2-N-benzyl-4-N-cyclohexyl-2-N,6-dimethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 46228418 |
| Molecular Formula | C19H26N4 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | 2-N-benzyl-4-N-cyclohexyl-2-N,6-dimethylpyrimidine-2,4-diamine |
| SMILES | Cc1cc(NC2CCCCC2)nc(N(C)Cc2ccccc2)n1 |
| InChI | InChI=1S/C19H26N4/c1-15-13-18(21-17-11-7-4-8-12-17)22-19(20-15)23(2)14-16-9-5-3-6-10-16/h3,5-6,9-10,13,17H,4,7-8,11-12,14H2,1-2H3,(H,20,21,22) |
| InChIKey | GTQLSDDNQDRTKU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |