C13H19N3 — CID 46228433
2-piperazin-1-yl-5,6,7,8-tetrahydroquinoline (PubChem CID 46228433) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 2-piperazin-1-yl-5,6,7,8-tetrahydroquinoline.
| Compound Name | 2-piperazin-1-yl-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 46228433 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 2-piperazin-1-yl-5,6,7,8-tetrahydroquinoline |
| SMILES | c1cc2c(nc1N1CCNCC1)CCCC2 |
| InChI | InChI=1S/C13H19N3/c1-2-4-12-11(3-1)5-6-13(15-12)16-9-7-14-8-10-16/h5-6,14H,1-4,7-10H2 |
| InChIKey | OHJFBSROVXQKFQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |