C48H60N8O6 — CID 46228486
1,10-bis(4-aminobutyl)-4,7,13,16-tetrabenzyl-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone (PubChem CID 46228486) has the molecular formula C48H60N8O6 and a molecular weight of 845.06 g/mol. Its IUPAC name is 1,10-bis(4-aminobutyl)-4,7,13,16-tetrabenzyl-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone.
| Compound Name | 1,10-bis(4-aminobutyl)-4,7,13,16-tetrabenzyl-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone |
|---|---|
| PubChem CID | 46228486 |
| Molecular Formula | C48H60N8O6 |
| Molecular Weight | 845.06 g/mol |
| Exact Mass | 844.46 |
| IUPAC Name | 1,10-bis(4-aminobutyl)-4,7,13,16-tetrabenzyl-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone |
| SMILES | NCCCCN1CC(=O)N(Cc2ccccc2)CC(=O)N(Cc2ccccc2)CC(=O)N(CCCCN)CC(=O)N(Cc2ccccc2)CC(=O)N(Cc2ccccc2)CC1=O |
| InChI | InChI=1S/C48H60N8O6/c49-25-13-15-27-51-33-46(60)56(32-42-23-11-4-12-24-42)38-48(62)54(30-40-19-7-2-8-20-40)36-44(58)52(28-16-14-26-50)34-45(59)55(31-41-21-9-3-10-22-41)37-47(61)53(35-43(51)57)29-39-17-5-1-6-18-39/h1-12,17-24H,13-16,25-38,49-50H2 |
| InChIKey | AJAQGORZCCCKGK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 173.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 62 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.06 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|