C37H55N5O4 — CID 46228838
N-[7-(7-aminoheptylamino)heptyl]-4-[3-(hydroxyamino)-3-oxopropyl]-5-(3-hydroxy-3,3-diphenylpropyl)-1H-pyrrole-2-carboxamide (PubChem CID 46228838) has the molecular formula C37H55N5O4 and a molecular weight of 633.88 g/mol. Its IUPAC name is N-[7-(7-aminoheptylamino)heptyl]-4-[3-(hydroxyamino)-3-oxopropyl]-5-(3-hydroxy-3,3-diphenylpropyl)-1H-pyrrole-2-carboxamide.
| Compound Name | N-[7-(7-aminoheptylamino)heptyl]-4-[3-(hydroxyamino)-3-oxopropyl]-5-(3-hydroxy-3,3-diphenylpropyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 46228838 |
| Molecular Formula | C37H55N5O4 |
| Molecular Weight | 633.88 g/mol |
| Exact Mass | 633.43 |
| IUPAC Name | N-[7-(7-aminoheptylamino)heptyl]-4-[3-(hydroxyamino)-3-oxopropyl]-5-(3-hydroxy-3,3-diphenylpropyl)-1H-pyrrole-2-carboxamide |
| SMILES | NCCCCCCCNCCCCCCCNC(=O)c1cc(CCC(=O)NO)c(CCC(O)(c2ccccc2)c2ccccc2)[nH]1 |
| InChI | InChI=1S/C37H55N5O4/c38-25-13-3-1-4-14-26-39-27-15-5-2-6-16-28-40-36(44)34-29-30(21-22-35(43)42-46)33(41-34)23-24-37(45,31-17-9-7-10-18-31)32-19-11-8-12-20-32/h7-12,17-20,29,39,41,45-46H,1-6,13-16,21-28,38H2,(H,40,44)(H,42,43) |
| InChIKey | LZMQBRWLXTUHPE-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 152.50 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.88 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|