C18H24N2O4 — CID 46229061
(1R,5R,7R)-3-benzyl-2-oxo-N-pentyl-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide (PubChem CID 46229061) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is (1R,5R,7R)-3-benzyl-2-oxo-N-pentyl-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide.
| Compound Name | (1R,5R,7R)-3-benzyl-2-oxo-N-pentyl-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide |
|---|---|
| PubChem CID | 46229061 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | (1R,5R,7R)-3-benzyl-2-oxo-N-pentyl-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide |
| SMILES | CCCCCNC(=O)[C@@H]1O[C@H]2CN(Cc3ccccc3)C(=O)[C@@H]1O2 |
| InChI | InChI=1S/C18H24N2O4/c1-2-3-7-10-19-17(21)15-16-18(22)20(12-14(23-15)24-16)11-13-8-5-4-6-9-13/h4-6,8-9,14-16H,2-3,7,10-12H2,1H3,(H,19,21)/t14-,15-,16-/m1/s1 |
| InChIKey | LKBFWJVEBQLPGG-BZUAXINKSA-N |
| XLogP | 1.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|